C13H14FN3S — CID 114012086
5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzenecarbothioamide (PubChem CID 114012086) has the molecular formula C13H14FN3S and a molecular weight of 263.34 g/mol. Its IUPAC name is 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzenecarbothioamide.
| Compound Name | 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 114012086 |
| Molecular Formula | C13H14FN3S |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzenecarbothioamide |
| SMILES | Cc1ncn(Cc2ccc(F)c(C(N)=S)c2)c1C |
| InChI | InChI=1S/C13H14FN3S/c1-8-9(2)17(7-16-8)6-10-3-4-12(14)11(5-10)13(15)18/h3-5,7H,6H2,1-2H3,(H2,15,18) |
| InChIKey | YOCNMDGHTZESCY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|