C13H13FN2OS2 — CID 107879671
5-[(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)methyl]-2-fluorobenzenecarbothioamide (PubChem CID 107879671) has the molecular formula C13H13FN2OS2 and a molecular weight of 296.39 g/mol. Its IUPAC name is 5-[(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)methyl]-2-fluorobenzenecarbothioamide.
| Compound Name | 5-[(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)methyl]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107879671 |
| Molecular Formula | C13H13FN2OS2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 5-[(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)methyl]-2-fluorobenzenecarbothioamide |
| SMILES | Cc1sc(=O)n(Cc2ccc(F)c(C(N)=S)c2)c1C |
| InChI | InChI=1S/C13H13FN2OS2/c1-7-8(2)19-13(17)16(7)6-9-3-4-11(14)10(5-9)12(15)18/h3-5H,6H2,1-2H3,(H2,15,18) |
| InChIKey | JZUNCGYPPLBIQO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|