C12H11BrN2O3S — CID 115557891
3-[(4-bromo-3-nitrophenyl)methyl]-4,5-dimethyl-1,3-thiazol-2-one (PubChem CID 115557891) has the molecular formula C12H11BrN2O3S and a molecular weight of 343.20 g/mol. Its IUPAC name is 3-[(4-bromo-3-nitrophenyl)methyl]-4,5-dimethyl-1,3-thiazol-2-one.
| Compound Name | 3-[(4-bromo-3-nitrophenyl)methyl]-4,5-dimethyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 115557891 |
| Molecular Formula | C12H11BrN2O3S |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 3-[(4-bromo-3-nitrophenyl)methyl]-4,5-dimethyl-1,3-thiazol-2-one |
| SMILES | Cc1sc(=O)n(Cc2ccc(Br)c([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C12H11BrN2O3S/c1-7-8(2)19-12(16)14(7)6-9-3-4-10(13)11(5-9)15(17)18/h3-5H,6H2,1-2H3 |
| InChIKey | AHTCINMFEYZAHZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 65.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|