C13H8BrN3O4 — CID 115557909
3-[(4-bromo-3-nitrophenyl)methyl]-[1,3]oxazolo[4,5-b]pyridin-2-one (PubChem CID 115557909) has the molecular formula C13H8BrN3O4 and a molecular weight of 350.13 g/mol. Its IUPAC name is 3-[(4-bromo-3-nitrophenyl)methyl]-[1,3]oxazolo[4,5-b]pyridin-2-one.
| Compound Name | 3-[(4-bromo-3-nitrophenyl)methyl]-[1,3]oxazolo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 115557909 |
| Molecular Formula | C13H8BrN3O4 |
| Molecular Weight | 350.13 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 3-[(4-bromo-3-nitrophenyl)methyl]-[1,3]oxazolo[4,5-b]pyridin-2-one |
| SMILES | O=c1oc2cccnc2n1Cc1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H8BrN3O4/c14-9-4-3-8(6-10(9)17(19)20)7-16-12-11(21-13(16)18)2-1-5-15-12/h1-6H,7H2 |
| InChIKey | UDEQWXMAMYVXPA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.13 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|