C16H18FN3S — CID 107879722
2-fluoro-5-[(2-methyl-4,5,6,7-tetrahydrobenzimidazol-1-yl)methyl]benzenecarbothioamide (PubChem CID 107879722) has the molecular formula C16H18FN3S and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-fluoro-5-[(2-methyl-4,5,6,7-tetrahydrobenzimidazol-1-yl)methyl]benzenecarbothioamide.
| Compound Name | 2-fluoro-5-[(2-methyl-4,5,6,7-tetrahydrobenzimidazol-1-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 107879722 |
| Molecular Formula | C16H18FN3S |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-fluoro-5-[(2-methyl-4,5,6,7-tetrahydrobenzimidazol-1-yl)methyl]benzenecarbothioamide |
| SMILES | Cc1nc2c(n1Cc1ccc(F)c(C(N)=S)c1)CCCC2 |
| InChI | InChI=1S/C16H18FN3S/c1-10-19-14-4-2-3-5-15(14)20(10)9-11-6-7-13(17)12(8-11)16(18)21/h6-8H,2-5,9H2,1H3,(H2,18,21) |
| InChIKey | YRDRPSUFKCLEIK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|