C12H13FN4S — CID 107879650
5-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-2-fluorobenzenecarbothioamide (PubChem CID 107879650) has the molecular formula C12H13FN4S and a molecular weight of 264.33 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-2-fluorobenzenecarbothioamide.
| Compound Name | 5-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107879650 |
| Molecular Formula | C12H13FN4S |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 5-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-2-fluorobenzenecarbothioamide |
| SMILES | Cc1nc(C)n(Cc2ccc(F)c(C(N)=S)c2)n1 |
| InChI | InChI=1S/C12H13FN4S/c1-7-15-8(2)17(16-7)6-9-3-4-11(13)10(5-9)12(14)18/h3-5H,6H2,1-2H3,(H2,14,18) |
| InChIKey | GTRIYWWCPITNGM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|