C12H14FN5O — CID 107458944
3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-4-fluorobenzohydrazide (PubChem CID 107458944) has the molecular formula C12H14FN5O and a molecular weight of 263.28 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-4-fluorobenzohydrazide.
| Compound Name | 3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 107458944 |
| Molecular Formula | C12H14FN5O |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-4-fluorobenzohydrazide |
| SMILES | Cc1nc(C)n(Cc2cc(C(=O)NN)ccc2F)n1 |
| InChI | InChI=1S/C12H14FN5O/c1-7-15-8(2)18(17-7)6-10-5-9(12(19)16-14)3-4-11(10)13/h3-5H,6,14H2,1-2H3,(H,16,19) |
| InChIKey | QJSHVNQYEIWCDI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|