C12H12FN3O3 — CID 107458852
3-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-fluorobenzohydrazide (PubChem CID 107458852) has the molecular formula C12H12FN3O3 and a molecular weight of 265.24 g/mol. Its IUPAC name is 3-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-fluorobenzohydrazide.
| Compound Name | 3-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 107458852 |
| Molecular Formula | C12H12FN3O3 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-fluorobenzohydrazide |
| SMILES | NNC(=O)c1ccc(F)c(CN2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C12H12FN3O3/c13-9-2-1-7(12(19)15-14)5-8(9)6-16-10(17)3-4-11(16)18/h1-2,5H,3-4,6,14H2,(H,15,19) |
| InChIKey | YZZUPTDXJGUVFG-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|