C12H10ClFN4O3 — CID 107459004
3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]-4-fluorobenzohydrazide (PubChem CID 107459004) has the molecular formula C12H10ClFN4O3 and a molecular weight of 312.69 g/mol. Its IUPAC name is 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]-4-fluorobenzohydrazide.
| Compound Name | 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 107459004 |
| Molecular Formula | C12H10ClFN4O3 |
| Molecular Weight | 312.69 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]-4-fluorobenzohydrazide |
| SMILES | NNC(=O)c1ccc(F)c(Cn2cc(Cl)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C12H10ClFN4O3/c13-8-5-18(12(21)16-11(8)20)4-7-3-6(10(19)17-15)1-2-9(7)14/h1-3,5H,4,15H2,(H,17,19)(H,16,20,21) |
| InChIKey | IOMWKWVJRSOQEI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.69 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|