About methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate
methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate (PubChem CID 71858130) has the molecular formula C11H9ClN2O5
and a molecular weight of 284.66 g/mol. Its IUPAC name is methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate |
| PubChem CID | 71858130 |
| Molecular Formula | C11H9ClN2O5 |
| Molecular Weight | 284.66 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1Cn1cc(Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H9ClN2O5/c1-18-10(16)8-6(2-3-19-8)4-14-5-7(12)9(15)13-11(14)17/h2-3,5H,4H2,1H3,(H,13,15,17) |
| InChIKey | GWWMJDKXOJGBNN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.66 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate?
The IUPAC name of methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate (CID 71858130) is methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate.
What is the SMILES notation for methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate?
The canonical SMILES for methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate is COC(=O)c1occc1Cn1cc(Cl)c(=O)[nH]c1=O.
What is the InChIKey of methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate?
The InChIKey is GWWMJDKXOJGBNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2O5/c1-18-10(16)8-6(2-3-19-8)4-14-5-7(12)9(15)13-11(14)17/h2-3,5H,4H2,1H3,(H,13,15,17).
What are the key properties of methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate?
methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate has a molecular weight of 284.66 g/mol, XLogP of 0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylate is sourced from PubChem (CID 71858130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).