C15H17NO4 — CID 106954118
methyl 3-[(4-hydroxy-2,5-dimethylanilino)methyl]furan-2-carboxylate (PubChem CID 106954118) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is methyl 3-[(4-hydroxy-2,5-dimethylanilino)methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[(4-hydroxy-2,5-dimethylanilino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 106954118 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | methyl 3-[(4-hydroxy-2,5-dimethylanilino)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CNc1cc(C)c(O)cc1C |
| InChI | InChI=1S/C15H17NO4/c1-9-7-13(17)10(2)6-12(9)16-8-11-4-5-20-14(11)15(18)19-3/h4-7,16-17H,8H2,1-3H3 |
| InChIKey | XMYHKYLFHKQXDH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|