C13H10BrF2NO3 — CID 102853126
methyl 3-[(5-bromo-2,4-difluoroanilino)methyl]furan-2-carboxylate (PubChem CID 102853126) has the molecular formula C13H10BrF2NO3 and a molecular weight of 346.13 g/mol. Its IUPAC name is methyl 3-[(5-bromo-2,4-difluoroanilino)methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[(5-bromo-2,4-difluoroanilino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 102853126 |
| Molecular Formula | C13H10BrF2NO3 |
| Molecular Weight | 346.13 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | methyl 3-[(5-bromo-2,4-difluoroanilino)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CNc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C13H10BrF2NO3/c1-19-13(18)12-7(2-3-20-12)6-17-11-4-8(14)9(15)5-10(11)16/h2-5,17H,6H2,1H3 |
| InChIKey | OTVCNEPNFKDLTG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.13 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|