C14H13FN2O4 — CID 43783764
methyl 3-[(5-carbamoyl-2-fluoroanilino)methyl]furan-2-carboxylate (PubChem CID 43783764) has the molecular formula C14H13FN2O4 and a molecular weight of 292.27 g/mol. Its IUPAC name is methyl 3-[(5-carbamoyl-2-fluoroanilino)methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[(5-carbamoyl-2-fluoroanilino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 43783764 |
| Molecular Formula | C14H13FN2O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | methyl 3-[(5-carbamoyl-2-fluoroanilino)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CNc1cc(C(N)=O)ccc1F |
| InChI | InChI=1S/C14H13FN2O4/c1-20-14(19)12-9(4-5-21-12)7-17-11-6-8(13(16)18)2-3-10(11)15/h2-6,17H,7H2,1H3,(H2,16,18) |
| InChIKey | IWGSXPVLWXZICQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |