C11H7Cl2FN2O2 — CID 112549898
5-chloro-1-[(2-chloro-3-fluorophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 112549898) has the molecular formula C11H7Cl2FN2O2 and a molecular weight of 289.09 g/mol. Its IUPAC name is 5-chloro-1-[(2-chloro-3-fluorophenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 5-chloro-1-[(2-chloro-3-fluorophenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112549898 |
| Molecular Formula | C11H7Cl2FN2O2 |
| Molecular Weight | 289.09 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 5-chloro-1-[(2-chloro-3-fluorophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2cccc(F)c2Cl)cc1Cl |
| InChI | InChI=1S/C11H7Cl2FN2O2/c12-7-5-16(11(18)15-10(7)17)4-6-2-1-3-8(14)9(6)13/h1-3,5H,4H2,(H,15,17,18) |
| InChIKey | CQEFALHQRATRFB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.09 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |