C12H7ClFN3O2 — CID 103760336
2-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]-4-fluorobenzonitrile (PubChem CID 103760336) has the molecular formula C12H7ClFN3O2 and a molecular weight of 279.66 g/mol. Its IUPAC name is 2-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 103760336 |
| Molecular Formula | C12H7ClFN3O2 |
| Molecular Weight | 279.66 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)cc1Cn1cc(Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H7ClFN3O2/c13-10-6-17(12(19)16-11(10)18)5-8-3-9(14)2-1-7(8)4-15/h1-3,6H,5H2,(H,16,18,19) |
| InChIKey | ARIRFWODVKREBE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.66 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |