C13H10ClN3O3 — CID 106793156
4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]-2-methoxybenzonitrile (PubChem CID 106793156) has the molecular formula C13H10ClN3O3 and a molecular weight of 291.69 g/mol. Its IUPAC name is 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]-2-methoxybenzonitrile.
| Compound Name | 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 106793156 |
| Molecular Formula | C13H10ClN3O3 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]-2-methoxybenzonitrile |
| SMILES | COc1cc(Cn2cc(Cl)c(=O)[nH]c2=O)ccc1C#N |
| InChI | InChI=1S/C13H10ClN3O3/c1-20-11-4-8(2-3-9(11)5-15)6-17-7-10(14)12(18)16-13(17)19/h2-4,7H,6H2,1H3,(H,16,18,19) |
| InChIKey | NFQLMZLRGAJPDS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |