C13H11N3O3 — CID 107103957
4-[(2,4-dioxo-1H-pyrimidin-3-yl)methyl]-2-methoxybenzonitrile (PubChem CID 107103957) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-[(2,4-dioxo-1H-pyrimidin-3-yl)methyl]-2-methoxybenzonitrile.
| Compound Name | 4-[(2,4-dioxo-1H-pyrimidin-3-yl)methyl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 107103957 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 4-[(2,4-dioxo-1H-pyrimidin-3-yl)methyl]-2-methoxybenzonitrile |
| SMILES | COc1cc(Cn2c(=O)cc[nH]c2=O)ccc1C#N |
| InChI | InChI=1S/C13H11N3O3/c1-19-11-6-9(2-3-10(11)7-14)8-16-12(17)4-5-15-13(16)18/h2-6H,8H2,1H3,(H,15,18) |
| InChIKey | AXTCKKRQWDUSFG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |