C13H14N2O4 — CID 107104033
3-[(3,4-dimethoxyphenyl)methyl]-1H-pyrimidine-2,4-dione (PubChem CID 107104033) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 107104033 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-1H-pyrimidine-2,4-dione |
| SMILES | COc1ccc(Cn2c(=O)cc[nH]c2=O)cc1OC |
| InChI | InChI=1S/C13H14N2O4/c1-18-10-4-3-9(7-11(10)19-2)8-15-12(16)5-6-14-13(15)17/h3-7H,8H2,1-2H3,(H,14,17) |
| InChIKey | TVFQFMUNXGXDFZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |