C20H22N4O4 — CID 134099857
1-[(3,4-dimethoxyphenyl)methyl]-4-(2,2-dimethylpropyl)-5,6-dioxopyrazine-2,3-dicarbonitrile (PubChem CID 134099857) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-4-(2,2-dimethylpropyl)-5,6-dioxopyrazine-2,3-dicarbonitrile.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-(2,2-dimethylpropyl)-5,6-dioxopyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 134099857 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-(2,2-dimethylpropyl)-5,6-dioxopyrazine-2,3-dicarbonitrile |
| SMILES | COc1ccc(Cn2c(C#N)c(C#N)n(CC(C)(C)C)c(=O)c2=O)cc1OC |
| InChI | InChI=1S/C20H22N4O4/c1-20(2,3)12-24-15(10-22)14(9-21)23(18(25)19(24)26)11-13-6-7-16(27-4)17(8-13)28-5/h6-8H,11-12H2,1-5H3 |
| InChIKey | GRSJDSHDGJDWIE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 110.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|