C15H18N2O4 — CID 63812375
3-[(3,4-dimethoxyphenyl)methyl]-1-ethylpyrimidine-2,4-dione (PubChem CID 63812375) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-1-ethylpyrimidine-2,4-dione.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-1-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63812375 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-1-ethylpyrimidine-2,4-dione |
| SMILES | CCn1ccc(=O)n(Cc2ccc(OC)c(OC)c2)c1=O |
| InChI | InChI=1S/C15H18N2O4/c1-4-16-8-7-14(18)17(15(16)19)10-11-5-6-12(20-2)13(9-11)21-3/h5-9H,4,10H2,1-3H3 |
| InChIKey | NEKBBHXVNBLPMF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |