C14H16N2O3 — CID 82484402
4-amino-1-[(3,4-dimethoxyphenyl)methyl]pyridin-2-one (PubChem CID 82484402) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-amino-1-[(3,4-dimethoxyphenyl)methyl]pyridin-2-one.
| Compound Name | 4-amino-1-[(3,4-dimethoxyphenyl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 82484402 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-amino-1-[(3,4-dimethoxyphenyl)methyl]pyridin-2-one |
| SMILES | COc1ccc(Cn2ccc(N)cc2=O)cc1OC |
| InChI | InChI=1S/C14H16N2O3/c1-18-12-4-3-10(7-13(12)19-2)9-16-6-5-11(15)8-14(16)17/h3-8H,9,15H2,1-2H3 |
| InChIKey | GWSLRSKANBPXFZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |