C16H15NO3S — CID 103990875
5-[(3,4-dimethoxyphenyl)methyl]thieno[3,2-c]pyridin-4-one (PubChem CID 103990875) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 5-[(3,4-dimethoxyphenyl)methyl]thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-[(3,4-dimethoxyphenyl)methyl]thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 103990875 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 5-[(3,4-dimethoxyphenyl)methyl]thieno[3,2-c]pyridin-4-one |
| SMILES | COc1ccc(Cn2ccc3sccc3c2=O)cc1OC |
| InChI | InChI=1S/C16H15NO3S/c1-19-13-4-3-11(9-14(13)20-2)10-17-7-5-15-12(16(17)18)6-8-21-15/h3-9H,10H2,1-2H3 |
| InChIKey | DOBNEIJLAMNSGD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |