C14H11NO2S — CID 116626911
5-[(4-hydroxyphenyl)methyl]thieno[3,2-c]pyridin-4-one (PubChem CID 116626911) has the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. Its IUPAC name is 5-[(4-hydroxyphenyl)methyl]thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-[(4-hydroxyphenyl)methyl]thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 116626911 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 5-[(4-hydroxyphenyl)methyl]thieno[3,2-c]pyridin-4-one |
| SMILES | O=c1c2ccsc2ccn1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H11NO2S/c16-11-3-1-10(2-4-11)9-15-7-5-13-12(14(15)17)6-8-18-13/h1-8,16H,9H2 |
| InChIKey | VIABPMUWJGJXKZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |