C14H16N4O3 — CID 63810746
3-[(3-ethyl-2,6-dioxopyrimidin-1-yl)methyl]benzohydrazide (PubChem CID 63810746) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 3-[(3-ethyl-2,6-dioxopyrimidin-1-yl)methyl]benzohydrazide.
| Compound Name | 3-[(3-ethyl-2,6-dioxopyrimidin-1-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 63810746 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-[(3-ethyl-2,6-dioxopyrimidin-1-yl)methyl]benzohydrazide |
| SMILES | CCn1ccc(=O)n(Cc2cccc(C(=O)NN)c2)c1=O |
| InChI | InChI=1S/C14H16N4O3/c1-2-17-7-6-12(19)18(14(17)21)9-10-4-3-5-11(8-10)13(20)16-15/h3-8H,2,9,15H2,1H3,(H,16,20) |
| InChIKey | XFVRQJFXNJUBOL-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|