C19H25BN2O4 — CID 113249610
1-ethyl-3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrimidine-2,4-dione (PubChem CID 113249610) has the molecular formula C19H25BN2O4 and a molecular weight of 356.23 g/mol. Its IUPAC name is 1-ethyl-3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-ethyl-3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 113249610 |
| Molecular Formula | C19H25BN2O4 |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-ethyl-3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrimidine-2,4-dione |
| SMILES | CCn1ccc(=O)n(Cc2cccc(B3OC(C)(C)C(C)(C)O3)c2)c1=O |
| InChI | InChI=1S/C19H25BN2O4/c1-6-21-11-10-16(23)22(17(21)24)13-14-8-7-9-15(12-14)20-25-18(2,3)19(4,5)26-20/h7-12H,6,13H2,1-5H3 |
| InChIKey | NICHUOPNYCGGRY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|