C20H22BN3O3 — CID 113249592
3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,3-benzotriazin-4-one (PubChem CID 113249592) has the molecular formula C20H22BN3O3 and a molecular weight of 363.23 g/mol. Its IUPAC name is 3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 113249592 |
| Molecular Formula | C20H22BN3O3 |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,3-benzotriazin-4-one |
| SMILES | CC1(C)OB(c2cccc(Cn3nnc4ccccc4c3=O)c2)OC1(C)C |
| InChI | InChI=1S/C20H22BN3O3/c1-19(2)20(3,4)27-21(26-19)15-9-7-8-14(12-15)13-24-18(25)16-10-5-6-11-17(16)22-23-24/h5-12H,13H2,1-4H3 |
| InChIKey | HGPQVEFUKCDNPE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|