C19H15N3O3 — CID 9010709
3-[(7-ethyl-2-oxochromen-4-yl)methyl]-1,2,3-benzotriazin-4-one (PubChem CID 9010709) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 3-[(7-ethyl-2-oxochromen-4-yl)methyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[(7-ethyl-2-oxochromen-4-yl)methyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 9010709 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-[(7-ethyl-2-oxochromen-4-yl)methyl]-1,2,3-benzotriazin-4-one |
| SMILES | CCc1ccc2c(Cn3nnc4ccccc4c3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H15N3O3/c1-2-12-7-8-14-13(10-18(23)25-17(14)9-12)11-22-19(24)15-5-3-4-6-16(15)20-21-22/h3-10H,2,11H2,1H3 |
| InChIKey | SVKFMGZIARSXMY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|