C9H9N3O2S — CID 71412255
3-(methylsulfinylmethyl)-1,2,3-benzotriazin-4-one (PubChem CID 71412255) has the molecular formula C9H9N3O2S and a molecular weight of 223.26 g/mol. Its IUPAC name is 3-(methylsulfinylmethyl)-1,2,3-benzotriazin-4-one.
| Compound Name | 3-(methylsulfinylmethyl)-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 71412255 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 3-(methylsulfinylmethyl)-1,2,3-benzotriazin-4-one |
| SMILES | CS(=O)Cn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C9H9N3O2S/c1-15(14)6-12-9(13)7-4-2-3-5-8(7)10-11-12/h2-5H,6H2,1H3 |
| InChIKey | SVPKBFUQPLZOGB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |