C9H8N4O3 — CID 99984183
N-hydroxy-2-(4-oxo-1,2,3-benzotriazin-3-yl)acetamide (PubChem CID 99984183) has the molecular formula C9H8N4O3 and a molecular weight of 220.19 g/mol. Its IUPAC name is N-hydroxy-2-(4-oxo-1,2,3-benzotriazin-3-yl)acetamide.
| Compound Name | N-hydroxy-2-(4-oxo-1,2,3-benzotriazin-3-yl)acetamide |
|---|---|
| PubChem CID | 99984183 |
| Molecular Formula | C9H8N4O3 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | N-hydroxy-2-(4-oxo-1,2,3-benzotriazin-3-yl)acetamide |
| SMILES | O=C(Cn1nnc2ccccc2c1=O)NO |
| InChI | InChI=1S/C9H8N4O3/c14-8(11-16)5-13-9(15)6-3-1-2-4-7(6)10-12-13/h1-4,16H,5H2,(H,11,14) |
| InChIKey | MDTPVIOGFVNALV-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|