C14H14N4O6 — CID 4894424
2-[[2-(4-oxo-1,2,3-benzotriazin-3-yl)acetyl]amino]pentanedioic acid (PubChem CID 4894424) has the molecular formula C14H14N4O6 and a molecular weight of 334.29 g/mol. Its IUPAC name is 2-[[2-(4-oxo-1,2,3-benzotriazin-3-yl)acetyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-(4-oxo-1,2,3-benzotriazin-3-yl)acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 4894424 |
| Molecular Formula | C14H14N4O6 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-[[2-(4-oxo-1,2,3-benzotriazin-3-yl)acetyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)Cn1nnc2ccccc2c1=O)C(=O)O |
| InChI | InChI=1S/C14H14N4O6/c19-11(15-10(14(23)24)5-6-12(20)21)7-18-13(22)8-3-1-2-4-9(8)16-17-18/h1-4,10H,5-7H2,(H,15,19)(H,20,21)(H,23,24) |
| InChIKey | RDUWCBAWUHFGHR-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |