C17H16N4O2 — CID 2714528
2-(4-oxo-1,2,3-benzotriazin-3-yl)-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 2714528) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-(4-oxo-1,2,3-benzotriazin-3-yl)-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2-(4-oxo-1,2,3-benzotriazin-3-yl)-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 2714528 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-(4-oxo-1,2,3-benzotriazin-3-yl)-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | C[C@H](NC(=O)Cn1nnc2ccccc2c1=O)c1ccccc1 |
| InChI | InChI=1S/C17H16N4O2/c1-12(13-7-3-2-4-8-13)18-16(22)11-21-17(23)14-9-5-6-10-15(14)19-20-21/h2-10,12H,11H2,1H3,(H,18,22)/t12-/m0/s1 |
| InChIKey | PGSIBSVOWOZOCM-LBPRGKRZSA-N |
| XLogP | 1.67 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |