C11H15N3O — CID 145233159
ethane;3-ethyl-1,2,3-benzotriazin-4-one (PubChem CID 145233159) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is ethane;3-ethyl-1,2,3-benzotriazin-4-one.
| Compound Name | ethane;3-ethyl-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 145233159 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | ethane;3-ethyl-1,2,3-benzotriazin-4-one |
| SMILES | CC.CCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C9H9N3O.C2H6/c1-2-12-9(13)7-5-3-4-6-8(7)10-11-12;1-2/h3-6H,2H2,1H3;1-2H3 |
| InChIKey | JTEGKXSXJMPVSA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |