About methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate
methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate (PubChem CID 62012357) has the molecular formula C13H16N4O3
and a molecular weight of 276.30 g/mol. Its IUPAC name is methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate |
| PubChem CID | 62012357 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate |
| SMILES | CCN(CC(=O)OC)Cn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C13H16N4O3/c1-3-16(8-12(18)20-2)9-17-13(19)10-6-4-5-7-11(10)14-15-17/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | CWFBUYOEEUXIEF-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate?
The IUPAC name of methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate (CID 62012357) is methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate.
What is the SMILES notation for methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate?
The canonical SMILES for methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate is CCN(CC(=O)OC)Cn1nnc2ccccc2c1=O.
What is the InChIKey of methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate?
The InChIKey is CWFBUYOEEUXIEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O3/c1-3-16(8-12(18)20-2)9-17-13(19)10-6-4-5-7-11(10)14-15-17/h4-7H,3,8-9H2,1-2H3.
What are the key properties of methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate?
methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate has a molecular weight of 276.30 g/mol, XLogP of 0.24, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[ethyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]acetate is sourced from PubChem (CID 62012357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).