C13H14N4O3 — CID 79276057
2-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl-prop-2-enylamino]acetic acid (PubChem CID 79276057) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79276057 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)Cn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C13H14N4O3/c1-2-7-16(8-12(18)19)9-17-13(20)10-5-3-4-6-11(10)14-15-17/h2-6H,1,7-9H2,(H,18,19) |
| InChIKey | MGFKJJFUZQTKLI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|