C11H13N3O3 — CID 66223426
3-(2,2-dimethoxyethyl)-1,2,3-benzotriazin-4-one (PubChem CID 66223426) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethyl)-1,2,3-benzotriazin-4-one.
| Compound Name | 3-(2,2-dimethoxyethyl)-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 66223426 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-(2,2-dimethoxyethyl)-1,2,3-benzotriazin-4-one |
| SMILES | COC(Cn1nnc2ccccc2c1=O)OC |
| InChI | InChI=1S/C11H13N3O3/c1-16-10(17-2)7-14-11(15)8-5-3-4-6-9(8)12-13-14/h3-6,10H,7H2,1-2H3 |
| InChIKey | ZCIQZXABZXVTKV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|