2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid

C12H13N3O4 — CID 63074080

IUPAC2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid
SMILESCCOC(Cn1nnc2ccccc2c1=O)C(=O)O
InChIInChI=1S/C12H13N3O4/c1-2-19-10(12(17)18)7-15-11(16)8-5-3-4-6-9(8)13-14-15/h3-6,10H,2,7H2,1H3,(H,17,18)
InChIKeyDDDCIABLNOBLSH-UHFFFAOYSA-N
MW263.25 g/mol
LogP0.28
Rot. Bonds5

About 2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid

2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid (PubChem CID 63074080) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid.

Molecular Properties

Compound Name2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid
PubChem CID63074080
Molecular FormulaC12H13N3O4
Molecular Weight263.25 g/mol
Exact Mass263.09
IUPAC Name2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid
SMILESCCOC(Cn1nnc2ccccc2c1=O)C(=O)O
InChIInChI=1S/C12H13N3O4/c1-2-19-10(12(17)18)7-15-11(16)8-5-3-4-6-9(8)13-14-15/h3-6,10H,2,7H2,1H3,(H,17,18)
InChIKeyDDDCIABLNOBLSH-UHFFFAOYSA-N
XLogP0.28
TPSA94.31 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.25
LogP ≤ 50.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid?
The IUPAC name of 2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid (CID 63074080) is 2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid.
What is the SMILES notation for 2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid?
The canonical SMILES for 2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid is CCOC(Cn1nnc2ccccc2c1=O)C(=O)O.
What is the InChIKey of 2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid?
The InChIKey is DDDCIABLNOBLSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O4/c1-2-19-10(12(17)18)7-15-11(16)8-5-3-4-6-9(8)13-14-15/h3-6,10H,2,7H2,1H3,(H,17,18).
What are the key properties of 2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid?
2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid has a molecular weight of 263.25 g/mol, XLogP of 0.28, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid is sourced from PubChem (CID 63074080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).