C19H15N3O4 — CID 17452608
3-[(4,8-dimethyl-2-oxochromen-7-yl)oxymethyl]-1,2,3-benzotriazin-4-one (PubChem CID 17452608) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 3-[(4,8-dimethyl-2-oxochromen-7-yl)oxymethyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[(4,8-dimethyl-2-oxochromen-7-yl)oxymethyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 17452608 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-[(4,8-dimethyl-2-oxochromen-7-yl)oxymethyl]-1,2,3-benzotriazin-4-one |
| SMILES | Cc1cc(=O)oc2c(C)c(OCn3nnc4ccccc4c3=O)ccc12 |
| InChI | InChI=1S/C19H15N3O4/c1-11-9-17(23)26-18-12(2)16(8-7-13(11)18)25-10-22-19(24)14-5-3-4-6-15(14)20-21-22/h3-9H,10H2,1-2H3 |
| InChIKey | RMSCYTRVDLJXFT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|