C19H16N4O3 — CID 18202513
4,8-dimethyl-7-[(1-phenyltetrazol-5-yl)methoxy]chromen-2-one (PubChem CID 18202513) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 4,8-dimethyl-7-[(1-phenyltetrazol-5-yl)methoxy]chromen-2-one.
| Compound Name | 4,8-dimethyl-7-[(1-phenyltetrazol-5-yl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 18202513 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4,8-dimethyl-7-[(1-phenyltetrazol-5-yl)methoxy]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c(C)c(OCc3nnnn3-c3ccccc3)ccc12 |
| InChI | InChI=1S/C19H16N4O3/c1-12-10-18(24)26-19-13(2)16(9-8-15(12)19)25-11-17-20-21-22-23(17)14-6-4-3-5-7-14/h3-10H,11H2,1-2H3 |
| InChIKey | DYVFPURANPBJOZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|