C16H16N2O4 — CID 8014740
3-[(7-ethyl-2-oxochromen-4-yl)methyl]-1-methylimidazolidine-2,4-dione (PubChem CID 8014740) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-[(7-ethyl-2-oxochromen-4-yl)methyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(7-ethyl-2-oxochromen-4-yl)methyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8014740 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3-[(7-ethyl-2-oxochromen-4-yl)methyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CCc1ccc2c(CN3C(=O)CN(C)C3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C16H16N2O4/c1-3-10-4-5-12-11(7-15(20)22-13(12)6-10)8-18-14(19)9-17(2)16(18)21/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | KGCDWUBLJFDRFK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|