C18H24NO3+ — CID 2101655
4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-7-ethylchromen-2-one (PubChem CID 2101655) has the molecular formula C18H24NO3+ and a molecular weight of 302.39 g/mol. Its IUPAC name is 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-7-ethylchromen-2-one.
| Compound Name | 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-7-ethylchromen-2-one |
|---|---|
| PubChem CID | 2101655 |
| Molecular Formula | C18H24NO3+ |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-7-ethylchromen-2-one |
| SMILES | CCc1ccc2c(C[NH+]3C[C@H](C)O[C@@H](C)C3)cc(=O)oc2c1 |
| InChI | InChI=1S/C18H23NO3/c1-4-14-5-6-16-15(8-18(20)22-17(16)7-14)11-19-9-12(2)21-13(3)10-19/h5-8,12-13H,4,9-11H2,1-3H3/p+1/t12-,13-/m0/s1 |
| InChIKey | DNKSPBPNNSTGTN-STQMWFEESA-O |
| XLogP | 1.55 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|