C22H23Br2N2O4S+ — CID 2461079
4-[[4-(2,5-dibromophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-7-ethylchromen-2-one (PubChem CID 2461079) has the molecular formula C22H23Br2N2O4S+ and a molecular weight of 571.31 g/mol. Its IUPAC name is 4-[[4-(2,5-dibromophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-7-ethylchromen-2-one.
| Compound Name | 4-[[4-(2,5-dibromophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-7-ethylchromen-2-one |
|---|---|
| PubChem CID | 2461079 |
| Molecular Formula | C22H23Br2N2O4S+ |
| Molecular Weight | 571.31 g/mol |
| Exact Mass | 568.97 |
| IUPAC Name | 4-[[4-(2,5-dibromophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-7-ethylchromen-2-one |
| SMILES | CCc1ccc2c(C[NH+]3CCN(S(=O)(=O)c4cc(Br)ccc4Br)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H22Br2N2O4S/c1-2-15-3-5-18-16(12-22(27)30-20(18)11-15)14-25-7-9-26(10-8-25)31(28,29)21-13-17(23)4-6-19(21)24/h3-6,11-13H,2,7-10,14H2,1H3/p+1 |
| InChIKey | YNEOTTATYIYTEA-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|