C22H24BrN2O4S+ — CID 2437872
4-[[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-7,8-dimethylchromen-2-one (PubChem CID 2437872) has the molecular formula C22H24BrN2O4S+ and a molecular weight of 492.42 g/mol. Its IUPAC name is 4-[[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 2437872 |
| Molecular Formula | C22H24BrN2O4S+ |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 4-[[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(C[NH+]3CCN(S(=O)(=O)c4ccc(Br)cc4)CC3)cc(=O)oc2c1C |
| InChI | InChI=1S/C22H23BrN2O4S/c1-15-3-8-20-17(13-21(26)29-22(20)16(15)2)14-24-9-11-25(12-10-24)30(27,28)19-6-4-18(23)5-7-19/h3-8,13H,9-12,14H2,1-2H3/p+1 |
| InChIKey | VPLDHTUGFWGJRW-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|