C16H20NO3+ — CID 7198646
7-hydroxy-8-methyl-4-(piperidin-1-ium-1-ylmethyl)chromen-2-one (PubChem CID 7198646) has the molecular formula C16H20NO3+ and a molecular weight of 274.34 g/mol. Its IUPAC name is 7-hydroxy-8-methyl-4-(piperidin-1-ium-1-ylmethyl)chromen-2-one.
| Compound Name | 7-hydroxy-8-methyl-4-(piperidin-1-ium-1-ylmethyl)chromen-2-one |
|---|---|
| PubChem CID | 7198646 |
| Molecular Formula | C16H20NO3+ |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 7-hydroxy-8-methyl-4-(piperidin-1-ium-1-ylmethyl)chromen-2-one |
| SMILES | Cc1c(O)ccc2c(C[NH+]3CCCCC3)cc(=O)oc12 |
| InChI | InChI=1S/C16H19NO3/c1-11-14(18)6-5-13-12(9-15(19)20-16(11)13)10-17-7-3-2-4-8-17/h5-6,9,18H,2-4,7-8,10H2,1H3/p+1 |
| InChIKey | CNMNNSCWAKJOEU-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|