C19H18BrNO3 — CID 8515574
4-[[(2-bromophenyl)methyl-methylamino]methyl]-7-hydroxy-8-methylchromen-2-one (PubChem CID 8515574) has the molecular formula C19H18BrNO3 and a molecular weight of 388.26 g/mol. Its IUPAC name is 4-[[(2-bromophenyl)methyl-methylamino]methyl]-7-hydroxy-8-methylchromen-2-one.
| Compound Name | 4-[[(2-bromophenyl)methyl-methylamino]methyl]-7-hydroxy-8-methylchromen-2-one |
|---|---|
| PubChem CID | 8515574 |
| Molecular Formula | C19H18BrNO3 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 4-[[(2-bromophenyl)methyl-methylamino]methyl]-7-hydroxy-8-methylchromen-2-one |
| SMILES | Cc1c(O)ccc2c(CN(C)Cc3ccccc3Br)cc(=O)oc12 |
| InChI | InChI=1S/C19H18BrNO3/c1-12-17(22)8-7-15-14(9-18(23)24-19(12)15)11-21(2)10-13-5-3-4-6-16(13)20/h3-9,22H,10-11H2,1-2H3 |
| InChIKey | PSLPIICMMGJZAL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|