C19H15NO3S2 — CID 55424966
4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-hydroxy-8-methylchromen-2-one (PubChem CID 55424966) has the molecular formula C19H15NO3S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-hydroxy-8-methylchromen-2-one.
| Compound Name | 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-hydroxy-8-methylchromen-2-one |
|---|---|
| PubChem CID | 55424966 |
| Molecular Formula | C19H15NO3S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-hydroxy-8-methylchromen-2-one |
| SMILES | Cc1c(O)ccc2c(CSC3=Nc4ccccc4CS3)cc(=O)oc12 |
| InChI | InChI=1S/C19H15NO3S2/c1-11-16(21)7-6-14-13(8-17(22)23-18(11)14)10-25-19-20-15-5-3-2-4-12(15)9-24-19/h2-8,21H,9-10H2,1H3 |
| InChIKey | LNLUZSIOJKGUQN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|