C20H18Cl2N2O4 — CID 27253817
N-(2,6-dichlorophenyl)-2-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-methylamino]acetamide (PubChem CID 27253817) has the molecular formula C20H18Cl2N2O4 and a molecular weight of 421.28 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-methylamino]acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 27253817 |
| Molecular Formula | C20H18Cl2N2O4 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-methylamino]acetamide |
| SMILES | Cc1c(O)ccc2c(CN(C)CC(=O)Nc3c(Cl)cccc3Cl)cc(=O)oc12 |
| InChI | InChI=1S/C20H18Cl2N2O4/c1-11-16(25)7-6-13-12(8-18(27)28-20(11)13)9-24(2)10-17(26)23-19-14(21)4-3-5-15(19)22/h3-8,25H,9-10H2,1-2H3,(H,23,26) |
| InChIKey | DUYKBVUWRURHPA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|