C25H29N3O4 — CID 4818836
2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 4818836) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4818836 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1ccc2c(CN(C)CC(=O)Nc3ccc(N4CCOCC4)cc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C25H29N3O4/c1-17-4-9-22-19(14-24(30)32-25(22)18(17)2)15-27(3)16-23(29)26-20-5-7-21(8-6-20)28-10-12-31-13-11-28/h4-9,14H,10-13,15-16H2,1-3H3,(H,26,29) |
| InChIKey | ADDQBFUAFXXYLM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|