C19H24N2O5S — CID 60508730
2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl-methylamino]-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 60508730) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl-methylamino]-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl-methylamino]-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 60508730 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-[(7,8-dimethyl-2-oxochromen-4-yl)methyl-methylamino]-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | Cc1ccc2c(CN(C)CC(=O)NC3CCS(=O)(=O)C3)cc(=O)oc2c1C |
| InChI | InChI=1S/C19H24N2O5S/c1-12-4-5-16-14(8-18(23)26-19(16)13(12)2)9-21(3)10-17(22)20-15-6-7-27(24,25)11-15/h4-5,8,15H,6-7,9-11H2,1-3H3,(H,20,22) |
| InChIKey | CNWBJIWWLGFXEZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|