C18H21NO6S — CID 96556991
N-[(3S)-1,1-dioxothiolan-3-yl]-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 96556991) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 96556991 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | Cc1c(C)c2ccc(OCC(=O)N[C@H]3CCS(=O)(=O)C3)c(C)c2oc1=O |
| InChI | InChI=1S/C18H21NO6S/c1-10-11(2)18(21)25-17-12(3)15(5-4-14(10)17)24-8-16(20)19-13-6-7-26(22,23)9-13/h4-5,13H,6-9H2,1-3H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | KPEMCSJCKOFDEE-ZDUSSCGKSA-N |
| XLogP | 1.40 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|