C16H17NO7S — CID 40816265
2-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 40816265) has the molecular formula C16H17NO7S and a molecular weight of 367.38 g/mol. Its IUPAC name is 2-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 40816265 |
| Molecular Formula | C16H17NO7S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | Cc1c(CC(=O)N[C@H]2CCS(=O)(=O)C2)c(=O)oc2c(O)c(O)ccc12 |
| InChI | InChI=1S/C16H17NO7S/c1-8-10-2-3-12(18)14(20)15(10)24-16(21)11(8)6-13(19)17-9-4-5-25(22,23)7-9/h2-3,9,18,20H,4-7H2,1H3,(H,17,19)/t9-/m0/s1 |
| InChIKey | RSIHHODLQFZVEB-VIFPVBQESA-N |
| XLogP | 0.36 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|